C24H24N2O6 — CID 20602135
2-[[2-[6-[4-(2-methoxyethoxy)phenoxy]-3-pyridinyl]acetyl]amino]-5-methylbenzoic acid (PubChem CID 20602135) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is 2-[[2-[6-[4-(2-methoxyethoxy)phenoxy]-3-pyridinyl]acetyl]amino]-5-methylbenzoic acid.
| Compound Name | 2-[[2-[6-[4-(2-methoxyethoxy)phenoxy]-3-pyridinyl]acetyl]amino]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 20602135 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 2-[[2-[6-[4-(2-methoxyethoxy)phenoxy]-3-pyridinyl]acetyl]amino]-5-methylbenzoic acid |
| SMILES | COCCOc1ccc(Oc2ccc(CC(=O)Nc3ccc(C)cc3C(=O)O)cn2)cc1 |
| InChI | InChI=1S/C24H24N2O6/c1-16-3-9-21(20(13-16)24(28)29)26-22(27)14-17-4-10-23(25-15-17)32-19-7-5-18(6-8-19)31-12-11-30-2/h3-10,13,15H,11-12,14H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | ACULNIPXSPFZJZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|