C25H25N3O9S — CID 20602098
2-[[2-[6-[4-[2-(2-methoxyethoxy)ethylsulfinyl]phenoxy]-3-pyridinyl]acetyl]amino]-5-nitrobenzoic acid (PubChem CID 20602098) has the molecular formula C25H25N3O9S and a molecular weight of 543.55 g/mol. Its IUPAC name is 2-[[2-[6-[4-[2-(2-methoxyethoxy)ethylsulfinyl]phenoxy]-3-pyridinyl]acetyl]amino]-5-nitrobenzoic acid.
| Compound Name | 2-[[2-[6-[4-[2-(2-methoxyethoxy)ethylsulfinyl]phenoxy]-3-pyridinyl]acetyl]amino]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 20602098 |
| Molecular Formula | C25H25N3O9S |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | 2-[[2-[6-[4-[2-(2-methoxyethoxy)ethylsulfinyl]phenoxy]-3-pyridinyl]acetyl]amino]-5-nitrobenzoic acid |
| SMILES | COCCOCCS(=O)c1ccc(Oc2ccc(CC(=O)Nc3ccc([N+](=O)[O-])cc3C(=O)O)cn2)cc1 |
| InChI | InChI=1S/C25H25N3O9S/c1-35-10-11-36-12-13-38(34)20-6-4-19(5-7-20)37-24-9-2-17(16-26-24)14-23(29)27-22-8-3-18(28(32)33)15-21(22)25(30)31/h2-9,15-16H,10-14H2,1H3,(H,27,29)(H,30,31) |
| InChIKey | QTQIRRDPPCSBGY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 167.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|