C25H26N2O6S — CID 20602078
2-[[2-[6-(4-pentan-3-ylsulfonylphenoxy)-3-pyridinyl]acetyl]amino]benzoic acid (PubChem CID 20602078) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is 2-[[2-[6-(4-pentan-3-ylsulfonylphenoxy)-3-pyridinyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[6-(4-pentan-3-ylsulfonylphenoxy)-3-pyridinyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20602078 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 2-[[2-[6-(4-pentan-3-ylsulfonylphenoxy)-3-pyridinyl]acetyl]amino]benzoic acid |
| SMILES | CCC(CC)S(=O)(=O)c1ccc(Oc2ccc(CC(=O)Nc3ccccc3C(=O)O)cn2)cc1 |
| InChI | InChI=1S/C25H26N2O6S/c1-3-19(4-2)34(31,32)20-12-10-18(11-13-20)33-24-14-9-17(16-26-24)15-23(28)27-22-8-6-5-7-21(22)25(29)30/h5-14,16,19H,3-4,15H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | FXYPDMKQRNIWCP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |