C28H32N2O5 — CID 20602070
2-[[2-[6-(4-pentan-3-yloxy-2-propan-2-ylphenoxy)-3-pyridinyl]acetyl]amino]benzoic acid (PubChem CID 20602070) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is 2-[[2-[6-(4-pentan-3-yloxy-2-propan-2-ylphenoxy)-3-pyridinyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[6-(4-pentan-3-yloxy-2-propan-2-ylphenoxy)-3-pyridinyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20602070 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 2-[[2-[6-(4-pentan-3-yloxy-2-propan-2-ylphenoxy)-3-pyridinyl]acetyl]amino]benzoic acid |
| SMILES | CCC(CC)Oc1ccc(Oc2ccc(CC(=O)Nc3ccccc3C(=O)O)cn2)c(C(C)C)c1 |
| InChI | InChI=1S/C28H32N2O5/c1-5-20(6-2)34-21-12-13-25(23(16-21)18(3)4)35-27-14-11-19(17-29-27)15-26(31)30-24-10-8-7-9-22(24)28(32)33/h7-14,16-18,20H,5-6,15H2,1-4H3,(H,30,31)(H,32,33) |
| InChIKey | HESREZMJRREYCU-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |