C22H24ClN3O2 — CID 10023740
3-[2-(1-benzylpiperidin-4-yl)ethyl]-7-chloro-1H-quinazoline-2,4-dione (PubChem CID 10023740) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 3-[2-(1-benzylpiperidin-4-yl)ethyl]-7-chloro-1H-quinazoline-2,4-dione.
| Compound Name | 3-[2-(1-benzylpiperidin-4-yl)ethyl]-7-chloro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 10023740 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 3-[2-(1-benzylpiperidin-4-yl)ethyl]-7-chloro-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cc(Cl)ccc2c(=O)n1CCC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H24ClN3O2/c23-18-6-7-19-20(14-18)24-22(28)26(21(19)27)13-10-16-8-11-25(12-9-16)15-17-4-2-1-3-5-17/h1-7,14,16H,8-13,15H2,(H,24,28) |
| InChIKey | LPMLUKYEDMRFFG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |