C22H25NO6 — CID 10023856
2-(3,4-dimethoxyphenyl)-5-methoxy-4-(methoxymethoxy)-1,3-dimethylindole-7-carbaldehyde (PubChem CID 10023856) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-methoxy-4-(methoxymethoxy)-1,3-dimethylindole-7-carbaldehyde.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-methoxy-4-(methoxymethoxy)-1,3-dimethylindole-7-carbaldehyde |
|---|---|
| PubChem CID | 10023856 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-methoxy-4-(methoxymethoxy)-1,3-dimethylindole-7-carbaldehyde |
| SMILES | COCOc1c(OC)cc(C=O)c2c1c(C)c(-c1ccc(OC)c(OC)c1)n2C |
| InChI | InChI=1S/C22H25NO6/c1-13-19-21(15(11-24)10-18(28-6)22(19)29-12-25-3)23(2)20(13)14-7-8-16(26-4)17(9-14)27-5/h7-11H,12H2,1-6H3 |
| InChIKey | FRKCQBUOLKKOEE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|