C24H27NO5 — CID 10386793
(E)-3-[5-methoxy-4-(methoxymethoxy)-1,3-dimethyl-2-(2-methylphenyl)indol-7-yl]-2-methylprop-2-enoic acid (PubChem CID 10386793) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is (E)-3-[5-methoxy-4-(methoxymethoxy)-1,3-dimethyl-2-(2-methylphenyl)indol-7-yl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[5-methoxy-4-(methoxymethoxy)-1,3-dimethyl-2-(2-methylphenyl)indol-7-yl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 10386793 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (E)-3-[5-methoxy-4-(methoxymethoxy)-1,3-dimethyl-2-(2-methylphenyl)indol-7-yl]-2-methylprop-2-enoic acid |
| SMILES | COCOc1c(OC)cc(/C=C(\C)C(=O)O)c2c1c(C)c(-c1ccccc1C)n2C |
| InChI | InChI=1S/C24H27NO5/c1-14-9-7-8-10-18(14)21-16(3)20-22(25(21)4)17(11-15(2)24(26)27)12-19(29-6)23(20)30-13-28-5/h7-12H,13H2,1-6H3,(H,26,27)/b15-11+ |
| InChIKey | ULVYEUBTGHBWJH-RVDMUPIBSA-N |
| XLogP | 4.94 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|