C24H24O5 — CID 11741233
(Z)-3-[5-ethyl-3-methoxy-4-(methoxymethoxy)naphthalen-1-yl]-2-phenylprop-2-enoic acid (PubChem CID 11741233) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is (Z)-3-[5-ethyl-3-methoxy-4-(methoxymethoxy)naphthalen-1-yl]-2-phenylprop-2-enoic acid.
| Compound Name | (Z)-3-[5-ethyl-3-methoxy-4-(methoxymethoxy)naphthalen-1-yl]-2-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 11741233 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (Z)-3-[5-ethyl-3-methoxy-4-(methoxymethoxy)naphthalen-1-yl]-2-phenylprop-2-enoic acid |
| SMILES | CCc1cccc2c(/C=C(\C(=O)O)c3ccccc3)cc(OC)c(OCOC)c12 |
| InChI | InChI=1S/C24H24O5/c1-4-16-11-8-12-19-18(13-20(24(25)26)17-9-6-5-7-10-17)14-21(28-3)23(22(16)19)29-15-27-2/h5-14H,4,15H2,1-3H3,(H,25,26)/b20-13- |
| InChIKey | LSCXALSBXHJSOA-MOSHPQCFSA-N |
| XLogP | 5.02 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|