C20H26O4 — CID 10471842
5-ethyl-4-(methoxymethoxy)-3-pentoxynaphthalene-1-carbaldehyde (PubChem CID 10471842) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 5-ethyl-4-(methoxymethoxy)-3-pentoxynaphthalene-1-carbaldehyde.
| Compound Name | 5-ethyl-4-(methoxymethoxy)-3-pentoxynaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 10471842 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 5-ethyl-4-(methoxymethoxy)-3-pentoxynaphthalene-1-carbaldehyde |
| SMILES | CCCCCOc1cc(C=O)c2cccc(CC)c2c1OCOC |
| InChI | InChI=1S/C20H26O4/c1-4-6-7-11-23-18-12-16(13-21)17-10-8-9-15(5-2)19(17)20(18)24-14-22-3/h8-10,12-13H,4-7,11,14H2,1-3H3 |
| InChIKey | FTCZNAVIFRJJBP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|