C55H72O13 — CID 10629675
1,6,11,16-tetrakis(2-butoxyethoxy)-4,13-bis(methoxymethoxy)hexahelicene-3-carbaldehyde (PubChem CID 10629675) has the molecular formula C55H72O13 and a molecular weight of 941.17 g/mol. Its IUPAC name is 1,6,11,16-tetrakis(2-butoxyethoxy)-4,13-bis(methoxymethoxy)hexahelicene-3-carbaldehyde.
| Compound Name | 1,6,11,16-tetrakis(2-butoxyethoxy)-4,13-bis(methoxymethoxy)hexahelicene-3-carbaldehyde |
|---|---|
| PubChem CID | 10629675 |
| Molecular Formula | C55H72O13 |
| Molecular Weight | 941.17 g/mol |
| Exact Mass | 940.50 |
| IUPAC Name | 1,6,11,16-tetrakis(2-butoxyethoxy)-4,13-bis(methoxymethoxy)hexahelicene-3-carbaldehyde |
| SMILES | CCCCOCCOc1cc2c(OCOC)ccc(OCCOCCCC)c2c2c1ccc1ccc3c(OCCOCCCC)cc4c(OCOC)c(C=O)cc(OCCOCCCC)c4c3c12 |
| InChI | InChI=1S/C55H72O13/c1-7-11-21-59-25-29-63-46-20-19-45(67-37-57-5)43-34-47(64-30-26-60-22-12-8-2)41-17-15-39-16-18-42-48(65-31-27-61-23-13-9-3)35-44-52(54(42)50(39)53(41)51(43)46)49(66-32-28-62-24-14-10-4)33-40(36-56)55(44)68-38-58-6/h15-20,33-36H,7-14,21-32,37-38H2,1-6H3 |
| InChIKey | SCTVPKMWVRBDMH-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 127.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.17 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|