C24H32O5 — CID 10250397
ethyl (Z)-3-[5-ethyl-4-(methoxymethoxy)-3-pentoxynaphthalen-1-yl]prop-2-enoate (PubChem CID 10250397) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is ethyl (Z)-3-[5-ethyl-4-(methoxymethoxy)-3-pentoxynaphthalen-1-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[5-ethyl-4-(methoxymethoxy)-3-pentoxynaphthalen-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10250397 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | ethyl (Z)-3-[5-ethyl-4-(methoxymethoxy)-3-pentoxynaphthalen-1-yl]prop-2-enoate |
| SMILES | CCCCCOc1cc(/C=C\C(=O)OCC)c2cccc(CC)c2c1OCOC |
| InChI | InChI=1S/C24H32O5/c1-5-8-9-15-28-21-16-19(13-14-22(25)27-7-3)20-12-10-11-18(6-2)23(20)24(21)29-17-26-4/h10-14,16H,5-9,15,17H2,1-4H3/b14-13- |
| InChIKey | MMNVYSFKEFXSSG-YPKPFQOOSA-N |
| XLogP | 5.53 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|