C21H26O5 — CID 10066966
ethyl (E)-3-[5-ethyl-3-methoxy-4-(methoxymethoxy)naphthalen-1-yl]but-2-enoate (PubChem CID 10066966) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is ethyl (E)-3-[5-ethyl-3-methoxy-4-(methoxymethoxy)naphthalen-1-yl]but-2-enoate.
| Compound Name | ethyl (E)-3-[5-ethyl-3-methoxy-4-(methoxymethoxy)naphthalen-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 10066966 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | ethyl (E)-3-[5-ethyl-3-methoxy-4-(methoxymethoxy)naphthalen-1-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)c1cc(OC)c(OCOC)c2c(CC)cccc12 |
| InChI | InChI=1S/C21H26O5/c1-6-15-9-8-10-16-17(14(3)11-19(22)25-7-2)12-18(24-5)21(20(15)16)26-13-23-4/h8-12H,6-7,13H2,1-5H3/b14-11+ |
| InChIKey | COTIDJUAYVDHFF-SDNWHVSQSA-N |
| XLogP | 4.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|