C24H23ClO6 — CID 19022302
ethyl 2-[5-[(4-chlorophenyl)methyl]-3-methoxy-4-(methoxymethoxy)naphthalen-1-yl]-2-oxoacetate (PubChem CID 19022302) has the molecular formula C24H23ClO6 and a molecular weight of 442.90 g/mol. Its IUPAC name is ethyl 2-[5-[(4-chlorophenyl)methyl]-3-methoxy-4-(methoxymethoxy)naphthalen-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[5-[(4-chlorophenyl)methyl]-3-methoxy-4-(methoxymethoxy)naphthalen-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 19022302 |
| Molecular Formula | C24H23ClO6 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | ethyl 2-[5-[(4-chlorophenyl)methyl]-3-methoxy-4-(methoxymethoxy)naphthalen-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(OC)c(OCOC)c2c(Cc3ccc(Cl)cc3)cccc12 |
| InChI | InChI=1S/C24H23ClO6/c1-4-30-24(27)22(26)19-13-20(29-3)23(31-14-28-2)21-16(6-5-7-18(19)21)12-15-8-10-17(25)11-9-15/h5-11,13H,4,12,14H2,1-3H3 |
| InChIKey | QSUQHXNMIWXKKV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|