C26H28O5 — CID 19022341
ethyl 2-[5-benzyl-4-(methoxymethoxy)-3-propylnaphthalen-1-yl]-2-oxoacetate (PubChem CID 19022341) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is ethyl 2-[5-benzyl-4-(methoxymethoxy)-3-propylnaphthalen-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[5-benzyl-4-(methoxymethoxy)-3-propylnaphthalen-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 19022341 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | ethyl 2-[5-benzyl-4-(methoxymethoxy)-3-propylnaphthalen-1-yl]-2-oxoacetate |
| SMILES | CCCc1cc(C(=O)C(=O)OCC)c2cccc(Cc3ccccc3)c2c1OCOC |
| InChI | InChI=1S/C26H28O5/c1-4-10-20-16-22(24(27)26(28)30-5-2)21-14-9-13-19(15-18-11-7-6-8-12-18)23(21)25(20)31-17-29-3/h6-9,11-14,16H,4-5,10,15,17H2,1-3H3 |
| InChIKey | OXNMAOIGKKKIKW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|