C22H28O6 — CID 10385609
ethyl (Z)-3-[5-ethyl-3-(2-methoxyethoxy)-4-(methoxymethoxy)naphthalen-1-yl]prop-2-enoate (PubChem CID 10385609) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is ethyl (Z)-3-[5-ethyl-3-(2-methoxyethoxy)-4-(methoxymethoxy)naphthalen-1-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[5-ethyl-3-(2-methoxyethoxy)-4-(methoxymethoxy)naphthalen-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10385609 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | ethyl (Z)-3-[5-ethyl-3-(2-methoxyethoxy)-4-(methoxymethoxy)naphthalen-1-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\c1cc(OCCOC)c(OCOC)c2c(CC)cccc12 |
| InChI | InChI=1S/C22H28O6/c1-5-16-8-7-9-18-17(10-11-20(23)26-6-2)14-19(27-13-12-24-3)22(21(16)18)28-15-25-4/h7-11,14H,5-6,12-13,15H2,1-4H3/b11-10- |
| InChIKey | BKUSYOJPUYILQS-KHPPLWFESA-N |
| XLogP | 3.99 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|