C18H20O4 — CID 10086171
(E)-3-(4-hydroxy-3-methoxy-5-propylnaphthalen-1-yl)-2-methylprop-2-enoic acid (PubChem CID 10086171) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3-methoxy-5-propylnaphthalen-1-yl)-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-(4-hydroxy-3-methoxy-5-propylnaphthalen-1-yl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 10086171 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (E)-3-(4-hydroxy-3-methoxy-5-propylnaphthalen-1-yl)-2-methylprop-2-enoic acid |
| SMILES | CCCc1cccc2c(/C=C(\C)C(=O)O)cc(OC)c(O)c12 |
| InChI | InChI=1S/C18H20O4/c1-4-6-12-7-5-8-14-13(9-11(2)18(20)21)10-15(22-3)17(19)16(12)14/h5,7-10,19H,4,6H2,1-3H3,(H,20,21)/b11-9+ |
| InChIKey | LZQPORMPGNLGRR-PKNBQFBNSA-N |
| XLogP | 3.99 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|