C21H21NO4 — CID 10315932
(E)-3-(4-hydroxy-5-methoxy-1,3-dimethyl-2-phenylindol-7-yl)-2-methylprop-2-enoic acid (PubChem CID 10315932) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-5-methoxy-1,3-dimethyl-2-phenylindol-7-yl)-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-(4-hydroxy-5-methoxy-1,3-dimethyl-2-phenylindol-7-yl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 10315932 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (E)-3-(4-hydroxy-5-methoxy-1,3-dimethyl-2-phenylindol-7-yl)-2-methylprop-2-enoic acid |
| SMILES | COc1cc(/C=C(\C)C(=O)O)c2c(c(C)c(-c3ccccc3)n2C)c1O |
| InChI | InChI=1S/C21H21NO4/c1-12(21(24)25)10-15-11-16(26-4)20(23)17-13(2)18(22(3)19(15)17)14-8-6-5-7-9-14/h5-11,23H,1-4H3,(H,24,25)/b12-10+ |
| InChIKey | RXZAFNSNSJUGLW-ZRDIBKRKSA-N |
| XLogP | 4.36 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|