C11H15NO2 — CID 79726797
2-methyl-3-(1,2,5-trimethylpyrrol-3-yl)prop-2-enoic acid (PubChem CID 79726797) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-methyl-3-(1,2,5-trimethylpyrrol-3-yl)prop-2-enoic acid.
| Compound Name | 2-methyl-3-(1,2,5-trimethylpyrrol-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 79726797 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-methyl-3-(1,2,5-trimethylpyrrol-3-yl)prop-2-enoic acid |
| SMILES | CC(=Cc1cc(C)n(C)c1C)C(=O)O |
| InChI | InChI=1S/C11H15NO2/c1-7(11(13)14)5-10-6-8(2)12(4)9(10)3/h5-6H,1-4H3,(H,13,14) |
| InChIKey | UXMVLLWSVMBMEU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|