C18H18O6 — CID 23193063
(E)-3-[3,4-bis[(E)-2-carboxyprop-1-enyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 23193063) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is (E)-3-[3,4-bis[(E)-2-carboxyprop-1-enyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[3,4-bis[(E)-2-carboxyprop-1-enyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 23193063 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (E)-3-[3,4-bis[(E)-2-carboxyprop-1-enyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1ccc(/C=C(\C)C(=O)O)c(/C=C(\C)C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C18H18O6/c1-10(16(19)20)6-13-4-5-14(7-11(2)17(21)22)15(9-13)8-12(3)18(23)24/h4-9H,1-3H3,(H,19,20)(H,21,22)(H,23,24)/b10-6+,11-7+,12-8+ |
| InChIKey | BGBWHTHBKNVLNY-LRVPIKKLSA-N |
| XLogP | 3.15 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|