C10H12N2O2 — CID 69361395
3-(3,4-diaminophenyl)-2-methylprop-2-enoic acid (PubChem CID 69361395) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 3-(3,4-diaminophenyl)-2-methylprop-2-enoic acid.
| Compound Name | 3-(3,4-diaminophenyl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 69361395 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3-(3,4-diaminophenyl)-2-methylprop-2-enoic acid |
| SMILES | CC(=Cc1ccc(N)c(N)c1)C(=O)O |
| InChI | InChI=1S/C10H12N2O2/c1-6(10(13)14)4-7-2-3-8(11)9(12)5-7/h2-5H,11-12H2,1H3,(H,13,14) |
| InChIKey | SUSVPNQRXIWCSS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|