C13H17NO4 — CID 18348021
(E)-3-[4,5-dimethoxy-2-(methylamino)phenyl]-2-methylprop-2-enoic acid (PubChem CID 18348021) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is (E)-3-[4,5-dimethoxy-2-(methylamino)phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4,5-dimethoxy-2-(methylamino)phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 18348021 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (E)-3-[4,5-dimethoxy-2-(methylamino)phenyl]-2-methylprop-2-enoic acid |
| SMILES | CNc1cc(OC)c(OC)cc1/C=C(\C)C(=O)O |
| InChI | InChI=1S/C13H17NO4/c1-8(13(15)16)5-9-6-11(17-3)12(18-4)7-10(9)14-2/h5-7,14H,1-4H3,(H,15,16)/b8-5+ |
| InChIKey | ZPXFQGVSYZKLHS-VMPITWQZSA-N |
| XLogP | 2.23 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|