About (E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one
(E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 70789310) has the molecular formula C22H26O7
and a molecular weight of 402.44 g/mol. Its IUPAC name is (E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one |
| PubChem CID | 70789310 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(\C)C(=O)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C22H26O7/c1-13(8-14-9-18(26-4)20(28-6)11-16(14)24-2)22(23)15-10-19(27-5)21(29-7)12-17(15)25-3/h8-12H,1-7H3/b13-8+ |
| InChIKey | XOPVDBKBFFOHQR-MDWZMJQESA-N |
| XLogP | 4.02 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one?
The IUPAC name of (E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one (CID 70789310) is (E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one.
What is the SMILES notation for (E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one?
The canonical SMILES for (E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one is COc1cc(OC)c(OC)cc1/C=C(\C)C(=O)c1cc(OC)c(OC)cc1OC.
What is the InChIKey of (E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one?
The InChIKey is XOPVDBKBFFOHQR-MDWZMJQESA-N. The full InChI is InChI=1S/C22H26O7/c1-13(8-14-9-18(26-4)20(28-6)11-16(14)24-2)22(23)15-10-19(27-5)21(29-7)12-17(15)25-3/h8-12H,1-7H3/b13-8+.
What are the key properties of (E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one?
(E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one has a molecular weight of 402.44 g/mol, XLogP of 4.02, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-methyl-1,3-bis(2,4,5-trimethoxyphenyl)prop-2-en-1-one is sourced from PubChem (CID 70789310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).