C11H16O9P2 — CID 130362555
[1-phosphono-2-(2,4,5-trimethoxyphenyl)ethenyl]phosphonic acid (PubChem CID 130362555) has the molecular formula C11H16O9P2 and a molecular weight of 354.19 g/mol. Its IUPAC name is [1-phosphono-2-(2,4,5-trimethoxyphenyl)ethenyl]phosphonic acid.
| Compound Name | [1-phosphono-2-(2,4,5-trimethoxyphenyl)ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 130362555 |
| Molecular Formula | C11H16O9P2 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | [1-phosphono-2-(2,4,5-trimethoxyphenyl)ethenyl]phosphonic acid |
| SMILES | COc1cc(OC)c(OC)cc1C=C(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C11H16O9P2/c1-18-8-6-10(20-3)9(19-2)4-7(8)5-11(21(12,13)14)22(15,16)17/h4-6H,1-3H3,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | RYNLXGZMCCOYRJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|