C12H18N2O3 — CID 71536298
N-methyl-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]methanamine (PubChem CID 71536298) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is N-methyl-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]methanamine.
| Compound Name | N-methyl-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]methanamine |
|---|---|
| PubChem CID | 71536298 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N-methyl-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]methanamine |
| SMILES | COc1cc(OC)c(OC)cc1/C=N/N(C)C |
| InChI | InChI=1S/C12H18N2O3/c1-14(2)13-8-9-6-11(16-4)12(17-5)7-10(9)15-3/h6-8H,1-5H3/b13-8+ |
| InChIKey | SCTXSTAFFBZAHP-MDWZMJQESA-N |
| XLogP | 1.61 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|