C22H23N2O3PS — CID 6901168
1-[(E)-(diphenylphosphinothioylhydrazinylidene)methyl]-2,4,5-trimethoxybenzene (PubChem CID 6901168) has the molecular formula C22H23N2O3PS and a molecular weight of 426.48 g/mol. Its IUPAC name is 1-[(E)-(diphenylphosphinothioylhydrazinylidene)methyl]-2,4,5-trimethoxybenzene.
| Compound Name | 1-[(E)-(diphenylphosphinothioylhydrazinylidene)methyl]-2,4,5-trimethoxybenzene |
|---|---|
| PubChem CID | 6901168 |
| Molecular Formula | C22H23N2O3PS |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1-[(E)-(diphenylphosphinothioylhydrazinylidene)methyl]-2,4,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c(OC)cc1/C=N/NP(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H23N2O3PS/c1-25-20-15-22(27-3)21(26-2)14-17(20)16-23-24-28(29,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-16H,1-3H3,(H,24,29)/b23-16+ |
| InChIKey | UQCZTDOLYJYFST-XQNSMLJCSA-N |
| XLogP | 3.68 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|