C11H12NO5- — CID 134117792
1,2,4-trimethoxy-5-(2-nitroethenyl)benzene (PubChem CID 134117792) has the molecular formula C11H12NO5- and a molecular weight of 238.22 g/mol. Its IUPAC name is 1,2,4-trimethoxy-5-(2-nitroethenyl)benzene.
| Compound Name | 1,2,4-trimethoxy-5-(2-nitroethenyl)benzene |
|---|---|
| PubChem CID | 134117792 |
| Molecular Formula | C11H12NO5- |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1,2,4-trimethoxy-5-(2-nitroethenyl)benzene |
| SMILES | COc1cc(OC)c(OC)cc1/C=[C-]/[N+](=O)[O-] |
| InChI | InChI=1S/C11H12NO5/c1-15-9-7-11(17-3)10(16-2)6-8(9)4-5-12(13)14/h4,6-7H,1-3H3/q-1 |
| InChIKey | CLACITTXACYWFK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|