C23H29F2N3O — CID 10023999
6-(3,4-difluoroanilino)-N-(3-piperidin-4-ylphenyl)hexanamide (PubChem CID 10023999) has the molecular formula C23H29F2N3O and a molecular weight of 401.50 g/mol. Its IUPAC name is 6-(3,4-difluoroanilino)-N-(3-piperidin-4-ylphenyl)hexanamide.
| Compound Name | 6-(3,4-difluoroanilino)-N-(3-piperidin-4-ylphenyl)hexanamide |
|---|---|
| PubChem CID | 10023999 |
| Molecular Formula | C23H29F2N3O |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 6-(3,4-difluoroanilino)-N-(3-piperidin-4-ylphenyl)hexanamide |
| SMILES | O=C(CCCCCNc1ccc(F)c(F)c1)Nc1cccc(C2CCNCC2)c1 |
| InChI | InChI=1S/C23H29F2N3O/c24-21-9-8-19(16-22(21)25)27-12-3-1-2-7-23(29)28-20-6-4-5-18(15-20)17-10-13-26-14-11-17/h4-6,8-9,15-17,26-27H,1-3,7,10-14H2,(H,28,29) |
| InChIKey | SDLKTDAJGGCHKG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|