C23H29FN2O2 — CID 174445363
N-(2-fluoro-5-piperidin-4-ylphenyl)-5-(3-methoxyphenyl)pentanamide (PubChem CID 174445363) has the molecular formula C23H29FN2O2 and a molecular weight of 384.50 g/mol. Its IUPAC name is N-(2-fluoro-5-piperidin-4-ylphenyl)-5-(3-methoxyphenyl)pentanamide.
| Compound Name | N-(2-fluoro-5-piperidin-4-ylphenyl)-5-(3-methoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 174445363 |
| Molecular Formula | C23H29FN2O2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-(2-fluoro-5-piperidin-4-ylphenyl)-5-(3-methoxyphenyl)pentanamide |
| SMILES | COc1cccc(CCCCC(=O)Nc2cc(C3CCNCC3)ccc2F)c1 |
| InChI | InChI=1S/C23H29FN2O2/c1-28-20-7-4-6-17(15-20)5-2-3-8-23(27)26-22-16-19(9-10-21(22)24)18-11-13-25-14-12-18/h4,6-7,9-10,15-16,18,25H,2-3,5,8,11-14H2,1H3,(H,26,27) |
| InChIKey | QJEWVTBXYQKLJW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|