C23H31ClN2O4S — CID 10027568
8-[(4-chlorophenyl)sulfonylamino]-4-[3-(4-methyl-3-pyridinyl)propyl]octanoic acid (PubChem CID 10027568) has the molecular formula C23H31ClN2O4S and a molecular weight of 467.03 g/mol. Its IUPAC name is 8-[(4-chlorophenyl)sulfonylamino]-4-[3-(4-methyl-3-pyridinyl)propyl]octanoic acid.
| Compound Name | 8-[(4-chlorophenyl)sulfonylamino]-4-[3-(4-methyl-3-pyridinyl)propyl]octanoic acid |
|---|---|
| PubChem CID | 10027568 |
| Molecular Formula | C23H31ClN2O4S |
| Molecular Weight | 467.03 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 8-[(4-chlorophenyl)sulfonylamino]-4-[3-(4-methyl-3-pyridinyl)propyl]octanoic acid |
| SMILES | Cc1ccncc1CCCC(CCCCNS(=O)(=O)c1ccc(Cl)cc1)CCC(=O)O |
| InChI | InChI=1S/C23H31ClN2O4S/c1-18-14-16-25-17-20(18)7-4-6-19(8-13-23(27)28)5-2-3-15-26-31(29,30)22-11-9-21(24)10-12-22/h9-12,14,16-17,19,26H,2-8,13,15H2,1H3,(H,27,28) |
| InChIKey | AYCXRQBBLSMBJB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.03 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|