C24H33ClN2O4S — CID 10050856
8-[(4-chlorophenyl)sulfonylamino]-2,2-dimethyl-4-(3-pyridin-3-ylpropyl)octanoic acid (PubChem CID 10050856) has the molecular formula C24H33ClN2O4S and a molecular weight of 481.06 g/mol. Its IUPAC name is 8-[(4-chlorophenyl)sulfonylamino]-2,2-dimethyl-4-(3-pyridin-3-ylpropyl)octanoic acid.
| Compound Name | 8-[(4-chlorophenyl)sulfonylamino]-2,2-dimethyl-4-(3-pyridin-3-ylpropyl)octanoic acid |
|---|---|
| PubChem CID | 10050856 |
| Molecular Formula | C24H33ClN2O4S |
| Molecular Weight | 481.06 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 8-[(4-chlorophenyl)sulfonylamino]-2,2-dimethyl-4-(3-pyridin-3-ylpropyl)octanoic acid |
| SMILES | CC(C)(CC(CCCCNS(=O)(=O)c1ccc(Cl)cc1)CCCc1cccnc1)C(=O)O |
| InChI | InChI=1S/C24H33ClN2O4S/c1-24(2,23(28)29)17-19(8-5-9-20-10-6-15-26-18-20)7-3-4-16-27-32(30,31)22-13-11-21(25)12-14-22/h6,10-15,18-19,27H,3-5,7-9,16-17H2,1-2H3,(H,28,29) |
| InChIKey | OAJJFMYYSWJNDD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.06 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|