C22H26NO4+ — CID 10028734
(1R,2R,7S,9S)-8,8-dimethyl-4,12-diphenyl-3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecane (PubChem CID 10028734) has the molecular formula C22H26NO4+ and a molecular weight of 368.45 g/mol. Its IUPAC name is (1R,2R,7S,9S)-8,8-dimethyl-4,12-diphenyl-3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecane.
| Compound Name | (1R,2R,7S,9S)-8,8-dimethyl-4,12-diphenyl-3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecane |
|---|---|
| PubChem CID | 10028734 |
| Molecular Formula | C22H26NO4+ |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (1R,2R,7S,9S)-8,8-dimethyl-4,12-diphenyl-3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecane |
| SMILES | C[N+]1(C)[C@H]2COC(c3ccccc3)O[C@H]2[C@@H]2OC(c3ccccc3)OC[C@@H]21 |
| InChI | InChI=1S/C22H26NO4/c1-23(2)17-13-24-21(15-9-5-3-6-10-15)26-19(17)20-18(23)14-25-22(27-20)16-11-7-4-8-12-16/h3-12,17-22H,13-14H2,1-2H3/q+1/t17-,18-,19+,20+,21?,22?/m0/s1 |
| InChIKey | WHQUEFQQKHPIBE-KCNMUOTRSA-N |
| XLogP | 3.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|