C22H32O13 — CID 10029104
[(2R,3R,4S,6R)-6-[[(3aR,6S,6aR)-6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-4-acetyloxy-3-(methoxymethoxy)-5-oxooxan-2-yl]methyl acetate (PubChem CID 10029104) has the molecular formula C22H32O13 and a molecular weight of 504.49 g/mol. Its IUPAC name is [(2R,3R,4S,6R)-6-[[(3aR,6S,6aR)-6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-4-acetyloxy-3-(methoxymethoxy)-5-oxooxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,6R)-6-[[(3aR,6S,6aR)-6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-4-acetyloxy-3-(methoxymethoxy)-5-oxooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10029104 |
| Molecular Formula | C22H32O13 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | [(2R,3R,4S,6R)-6-[[(3aR,6S,6aR)-6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-4-acetyloxy-3-(methoxymethoxy)-5-oxooxan-2-yl]methyl acetate |
| SMILES | COCO[C@H]1[C@H](OC(C)=O)C(=O)[C@@H](CC2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OC(C)=O)O[C@@H]1COC(C)=O |
| InChI | InChI=1S/C22H32O13/c1-10(23)28-8-15-17(29-9-27-6)19(31-12(3)25)16(26)13(32-15)7-14-18(30-11(2)24)20-21(33-14)35-22(4,5)34-20/h13-15,17-21H,7-9H2,1-6H3/t13-,14?,15-,17-,18+,19-,20-,21-/m1/s1 |
| InChIKey | WSBXVAJKMUWKPD-UTQROFFKSA-N |
| XLogP | 0.00 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|