C12H14O9 — CID 22812897
[(2S,3R,3aS,6S,6aS)-2,6-diacetyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate (PubChem CID 22812897) has the molecular formula C12H14O9 and a molecular weight of 302.24 g/mol. Its IUPAC name is [(2S,3R,3aS,6S,6aS)-2,6-diacetyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate.
| Compound Name | [(2S,3R,3aS,6S,6aS)-2,6-diacetyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate |
|---|---|
| PubChem CID | 22812897 |
| Molecular Formula | C12H14O9 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | [(2S,3R,3aS,6S,6aS)-2,6-diacetyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@H]2[C@H](OC(=O)[C@H]2OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H14O9/c1-4(13)17-9-7-8(20-11(9)16)10(18-5(2)14)12(21-7)19-6(3)15/h7-10,12H,1-3H3/t7-,8-,9-,10+,12+/m0/s1 |
| InChIKey | JBXFFCVIQJCKLE-OFKSJOQMSA-N |
| XLogP | -0.94 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|