C10H11F3O6 — CID 138980615
(1S,2R,6R,8S,9R)-4,4-dimethyl-9-(trifluoromethoxy)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one (PubChem CID 138980615) has the molecular formula C10H11F3O6 and a molecular weight of 284.19 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R)-4,4-dimethyl-9-(trifluoromethoxy)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one.
| Compound Name | (1S,2R,6R,8S,9R)-4,4-dimethyl-9-(trifluoromethoxy)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
|---|---|
| PubChem CID | 138980615 |
| Molecular Formula | C10H11F3O6 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (1S,2R,6R,8S,9R)-4,4-dimethyl-9-(trifluoromethoxy)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](OC(=O)[C@@H]3OC(F)(F)F)[C@H]2O1 |
| InChI | InChI=1S/C10H11F3O6/c1-9(2)17-6-4-3(16-8(6)19-9)5(7(14)15-4)18-10(11,12)13/h3-6,8H,1-2H3/t3-,4-,5+,6+,8+/m0/s1 |
| InChIKey | TUSBSNAVXAGJJO-XLIHNKEPSA-N |
| XLogP | 0.69 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |