C25H20ClFN4O3S — CID 10029343
(E)-3-(1-aminoisoquinolin-7-yl)-N-[2-chloro-4-(2-sulfamoylphenyl)phenyl]-2-fluorobut-2-enamide (PubChem CID 10029343) has the molecular formula C25H20ClFN4O3S and a molecular weight of 510.98 g/mol. Its IUPAC name is (E)-3-(1-aminoisoquinolin-7-yl)-N-[2-chloro-4-(2-sulfamoylphenyl)phenyl]-2-fluorobut-2-enamide.
| Compound Name | (E)-3-(1-aminoisoquinolin-7-yl)-N-[2-chloro-4-(2-sulfamoylphenyl)phenyl]-2-fluorobut-2-enamide |
|---|---|
| PubChem CID | 10029343 |
| Molecular Formula | C25H20ClFN4O3S |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | (E)-3-(1-aminoisoquinolin-7-yl)-N-[2-chloro-4-(2-sulfamoylphenyl)phenyl]-2-fluorobut-2-enamide |
| SMILES | C/C(=C(\F)C(=O)Nc1ccc(-c2ccccc2S(N)(=O)=O)cc1Cl)c1ccc2ccnc(N)c2c1 |
| InChI | InChI=1S/C25H20ClFN4O3S/c1-14(16-7-6-15-10-11-30-24(28)19(15)12-16)23(27)25(32)31-21-9-8-17(13-20(21)26)18-4-2-3-5-22(18)35(29,33)34/h2-13H,1H3,(H2,28,30)(H,31,32)(H2,29,33,34)/b23-14+ |
| InChIKey | PZQXOASUPDYJBC-OEAKJJBVSA-N |
| XLogP | 5.12 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|