C25H21FN4O3S — CID 22458381
(Z)-3-(1-aminoisoquinolin-7-yl)-2-fluoro-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide (PubChem CID 22458381) has the molecular formula C25H21FN4O3S and a molecular weight of 476.53 g/mol. Its IUPAC name is (Z)-3-(1-aminoisoquinolin-7-yl)-2-fluoro-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide.
| Compound Name | (Z)-3-(1-aminoisoquinolin-7-yl)-2-fluoro-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 22458381 |
| Molecular Formula | C25H21FN4O3S |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (Z)-3-(1-aminoisoquinolin-7-yl)-2-fluoro-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide |
| SMILES | C/C(=C(/F)C(=O)Nc1ccc(-c2ccccc2S(N)(=O)=O)cc1)c1ccc2ccnc(N)c2c1 |
| InChI | InChI=1S/C25H21FN4O3S/c1-15(18-7-6-17-12-13-29-24(27)21(17)14-18)23(26)25(31)30-19-10-8-16(9-11-19)20-4-2-3-5-22(20)34(28,32)33/h2-14H,1H3,(H2,27,29)(H,30,31)(H2,28,32,33)/b23-15- |
| InChIKey | SIQLZBWCHLFTRE-HAHDFKILSA-N |
| XLogP | 4.47 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|