C18H17F2N3O2S — CID 70696122
N-[3-(3-aminoisoquinolin-7-yl)-2,4-difluorophenyl]propane-1-sulfonamide (PubChem CID 70696122) has the molecular formula C18H17F2N3O2S and a molecular weight of 377.42 g/mol. Its IUPAC name is N-[3-(3-aminoisoquinolin-7-yl)-2,4-difluorophenyl]propane-1-sulfonamide.
| Compound Name | N-[3-(3-aminoisoquinolin-7-yl)-2,4-difluorophenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 70696122 |
| Molecular Formula | C18H17F2N3O2S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[3-(3-aminoisoquinolin-7-yl)-2,4-difluorophenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(F)c(-c2ccc3cc(N)ncc3c2)c1F |
| InChI | InChI=1S/C18H17F2N3O2S/c1-2-7-26(24,25)23-15-6-5-14(19)17(18(15)20)12-4-3-11-9-16(21)22-10-13(11)8-12/h3-6,8-10,23H,2,7H2,1H3,(H2,21,22) |
| InChIKey | ARJQWXGFNXYBIQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |