C24H20FN5O3S — CID 22458368
(Z)-3-(4-aminoquinazolin-6-yl)-2-fluoro-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide (PubChem CID 22458368) has the molecular formula C24H20FN5O3S and a molecular weight of 477.52 g/mol. Its IUPAC name is (Z)-3-(4-aminoquinazolin-6-yl)-2-fluoro-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide.
| Compound Name | (Z)-3-(4-aminoquinazolin-6-yl)-2-fluoro-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 22458368 |
| Molecular Formula | C24H20FN5O3S |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | (Z)-3-(4-aminoquinazolin-6-yl)-2-fluoro-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide |
| SMILES | C/C(=C(/F)C(=O)Nc1ccc(-c2ccccc2S(N)(=O)=O)cc1)c1ccc2ncnc(N)c2c1 |
| InChI | InChI=1S/C24H20FN5O3S/c1-14(16-8-11-20-19(12-16)23(26)29-13-28-20)22(25)24(31)30-17-9-6-15(7-10-17)18-4-2-3-5-21(18)34(27,32)33/h2-13H,1H3,(H,30,31)(H2,26,28,29)(H2,27,32,33)/b22-14- |
| InChIKey | QONBQPBZXCABLB-HMAPJEAMSA-N |
| XLogP | 3.87 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|