C32H34OS3 — CID 10029957
(2R,3S,4S)-4-methyl-7-phenyl-3,5,5-tris(phenylsulfanyl)heptan-2-ol (PubChem CID 10029957) has the molecular formula C32H34OS3 and a molecular weight of 530.82 g/mol. Its IUPAC name is (2R,3S,4S)-4-methyl-7-phenyl-3,5,5-tris(phenylsulfanyl)heptan-2-ol.
| Compound Name | (2R,3S,4S)-4-methyl-7-phenyl-3,5,5-tris(phenylsulfanyl)heptan-2-ol |
|---|---|
| PubChem CID | 10029957 |
| Molecular Formula | C32H34OS3 |
| Molecular Weight | 530.82 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | (2R,3S,4S)-4-methyl-7-phenyl-3,5,5-tris(phenylsulfanyl)heptan-2-ol |
| SMILES | C[C@@H](O)[C@@H](Sc1ccccc1)[C@H](C)C(CCc1ccccc1)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C32H34OS3/c1-25(31(26(2)33)34-28-17-9-4-10-18-28)32(35-29-19-11-5-12-20-29,36-30-21-13-6-14-22-30)24-23-27-15-7-3-8-16-27/h3-22,25-26,31,33H,23-24H2,1-2H3/t25-,26+,31-/m0/s1 |
| InChIKey | VDBJJMACEWKDCA-HEHLMWRFSA-N |
| XLogP | 9.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.82 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|