C33H35N3O6 — CID 10030905
[(2R,3R,4R,5S,6R)-5-azido-3,4-bis(phenylmethoxy)-6-(4-phenylmethoxybut-1-ynyl)oxan-2-yl]methyl acetate (PubChem CID 10030905) has the molecular formula C33H35N3O6 and a molecular weight of 569.66 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-5-azido-3,4-bis(phenylmethoxy)-6-(4-phenylmethoxybut-1-ynyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-5-azido-3,4-bis(phenylmethoxy)-6-(4-phenylmethoxybut-1-ynyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10030905 |
| Molecular Formula | C33H35N3O6 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-5-azido-3,4-bis(phenylmethoxy)-6-(4-phenylmethoxybut-1-ynyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](C#CCCOCc2ccccc2)[C@H](N=[N+]=[N-])[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H35N3O6/c1-25(37)39-24-30-32(40-22-27-15-7-3-8-16-27)33(41-23-28-17-9-4-10-18-28)31(35-36-34)29(42-30)19-11-12-20-38-21-26-13-5-2-6-14-26/h2-10,13-18,29-33H,12,20-24H2,1H3/t29-,30-,31+,32+,33-/m1/s1 |
| InChIKey | CEFLPIQDRZXNNX-UZGUBXJASA-N |
| XLogP | 5.78 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|