C21H32FN3O5Si — CID 20753307
[(2R,3S,4R,5R,6S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-4-phenylmethoxyoxan-2-yl]methyl acetate (PubChem CID 20753307) has the molecular formula C21H32FN3O5Si and a molecular weight of 453.59 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-4-phenylmethoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-4-phenylmethoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 20753307 |
| Molecular Formula | C21H32FN3O5Si |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-4-phenylmethoxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](F)C(N=[N+]=[N-])[C@@H](OCc2ccccc2)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32FN3O5Si/c1-14(26)27-13-16-18(30-31(5,6)21(2,3)4)19(17(24-25-23)20(22)29-16)28-12-15-10-8-7-9-11-15/h7-11,16-20H,12-13H2,1-6H3/t16-,17?,18-,19-,20-/m1/s1 |
| InChIKey | ITVFTBLUOQRKSN-HRCBOCMUSA-N |
| XLogP | 4.90 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|