C17H20FN3O6 — CID 135024293
[(3R,6S)-6-acetyloxy-5-azido-4-fluoro-3-phenylmethoxyoxan-2-yl]methyl acetate (PubChem CID 135024293) has the molecular formula C17H20FN3O6 and a molecular weight of 381.36 g/mol. Its IUPAC name is [(3R,6S)-6-acetyloxy-5-azido-4-fluoro-3-phenylmethoxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-6-acetyloxy-5-azido-4-fluoro-3-phenylmethoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135024293 |
| Molecular Formula | C17H20FN3O6 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [(3R,6S)-6-acetyloxy-5-azido-4-fluoro-3-phenylmethoxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](OC(C)=O)C(N=[N+]=[N-])C(F)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C17H20FN3O6/c1-10(22)24-9-13-16(25-8-12-6-4-3-5-7-12)14(18)15(20-21-19)17(27-13)26-11(2)23/h3-7,13-17H,8-9H2,1-2H3/t13?,14?,15?,16-,17-/m1/s1 |
| InChIKey | HIVDFVXHKDTMOH-MJYABGSSSA-N |
| XLogP | 2.44 |
| TPSA | 119.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|