C23H22F5N3O6 — CID 134878444
[(2R,3R,4R,5R)-5-azido-6-hydroxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 134878444) has the molecular formula C23H22F5N3O6 and a molecular weight of 531.43 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-azido-6-hydroxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [(2R,3R,4R,5R)-5-azido-6-hydroxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 134878444 |
| Molecular Formula | C23H22F5N3O6 |
| Molecular Weight | 531.43 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | [(2R,3R,4R,5R)-5-azido-6-hydroxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | [N-]=[N+]=N[C@H]1C(O)O[C@H](COCc2ccccc2)[C@H](OC(=O)C(F)(F)C(F)(F)F)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H22F5N3O6/c24-22(25,23(26,27)28)21(33)37-18-16(13-34-11-14-7-3-1-4-8-14)36-20(32)17(30-31-29)19(18)35-12-15-9-5-2-6-10-15/h1-10,16-20,32H,11-13H2/t16-,17-,18+,19-,20?/m1/s1 |
| InChIKey | GQGXNRUHTSWJDD-QUIYGKKVSA-N |
| XLogP | 4.29 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|