C23H25F2N3O5 — CID 11554409
[(2S,4R)-2-azido-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-difluoro-4-phenylmethoxybutyl] benzoate (PubChem CID 11554409) has the molecular formula C23H25F2N3O5 and a molecular weight of 461.47 g/mol. Its IUPAC name is [(2S,4R)-2-azido-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-difluoro-4-phenylmethoxybutyl] benzoate.
| Compound Name | [(2S,4R)-2-azido-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-difluoro-4-phenylmethoxybutyl] benzoate |
|---|---|
| PubChem CID | 11554409 |
| Molecular Formula | C23H25F2N3O5 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | [(2S,4R)-2-azido-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-difluoro-4-phenylmethoxybutyl] benzoate |
| SMILES | CC1(C)OC[C@H]([C@@H](OCc2ccccc2)C(F)(F)[C@H](COC(=O)c2ccccc2)N=[N+]=[N-])O1 |
| InChI | InChI=1S/C23H25F2N3O5/c1-22(2)32-14-18(33-22)20(30-13-16-9-5-3-6-10-16)23(24,25)19(27-28-26)15-31-21(29)17-11-7-4-8-12-17/h3-12,18-20H,13-15H2,1-2H3/t18-,19+,20-/m1/s1 |
| InChIKey | CMXIZCZSBKIJTG-HSALFYBXSA-N |
| XLogP | 4.89 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|