C17H18F3N3O8S — CID 134881088
[(3aR,5R,6R,6aR)-5-[(1R)-1-azido-2-(trifluoromethylsulfonyloxy)ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzoate (PubChem CID 134881088) has the molecular formula C17H18F3N3O8S and a molecular weight of 481.41 g/mol. Its IUPAC name is [(3aR,5R,6R,6aR)-5-[(1R)-1-azido-2-(trifluoromethylsulfonyloxy)ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzoate.
| Compound Name | [(3aR,5R,6R,6aR)-5-[(1R)-1-azido-2-(trifluoromethylsulfonyloxy)ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzoate |
|---|---|
| PubChem CID | 134881088 |
| Molecular Formula | C17H18F3N3O8S |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | [(3aR,5R,6R,6aR)-5-[(1R)-1-azido-2-(trifluoromethylsulfonyloxy)ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzoate |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H](COS(=O)(=O)C(F)(F)F)N=[N+]=[N-])[C@@H](OC(=O)c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C17H18F3N3O8S/c1-16(2)30-13-12(28-14(24)9-6-4-3-5-7-9)11(29-15(13)31-16)10(22-23-21)8-27-32(25,26)17(18,19)20/h3-7,10-13,15H,8H2,1-2H3/t10-,11-,12-,13-,15-/m1/s1 |
| InChIKey | QXXOGLAPGHORCN-FTQJZPFOSA-N |
| XLogP | 2.63 |
| TPSA | 146.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|