C24H25F2N3O7 — CID 11540670
[(2R,4R,5S)-5,6-diacetyloxy-2-azido-3,3-difluoro-4-phenylmethoxyhexyl] benzoate (PubChem CID 11540670) has the molecular formula C24H25F2N3O7 and a molecular weight of 505.47 g/mol. Its IUPAC name is [(2R,4R,5S)-5,6-diacetyloxy-2-azido-3,3-difluoro-4-phenylmethoxyhexyl] benzoate.
| Compound Name | [(2R,4R,5S)-5,6-diacetyloxy-2-azido-3,3-difluoro-4-phenylmethoxyhexyl] benzoate |
|---|---|
| PubChem CID | 11540670 |
| Molecular Formula | C24H25F2N3O7 |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | [(2R,4R,5S)-5,6-diacetyloxy-2-azido-3,3-difluoro-4-phenylmethoxyhexyl] benzoate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@@H](OCc1ccccc1)C(F)(F)[C@@H](COC(=O)c1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C24H25F2N3O7/c1-16(30)33-14-20(36-17(2)31)22(34-13-18-9-5-3-6-10-18)24(25,26)21(28-29-27)15-35-23(32)19-11-7-4-8-12-19/h3-12,20-22H,13-15H2,1-2H3/t20-,21+,22+/m0/s1 |
| InChIKey | VGOZAJMFVGEEEU-BHDDXSALSA-N |
| XLogP | 4.24 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|