C18H16F3N3O3 — CID 11222691
[(2S,3S)-3-azido-4,4,4-trifluoro-1-phenylmethoxybutan-2-yl] benzoate (PubChem CID 11222691) has the molecular formula C18H16F3N3O3 and a molecular weight of 379.34 g/mol. Its IUPAC name is [(2S,3S)-3-azido-4,4,4-trifluoro-1-phenylmethoxybutan-2-yl] benzoate.
| Compound Name | [(2S,3S)-3-azido-4,4,4-trifluoro-1-phenylmethoxybutan-2-yl] benzoate |
|---|---|
| PubChem CID | 11222691 |
| Molecular Formula | C18H16F3N3O3 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | [(2S,3S)-3-azido-4,4,4-trifluoro-1-phenylmethoxybutan-2-yl] benzoate |
| SMILES | [N-]=[N+]=N[C@@H]([C@@H](COCc1ccccc1)OC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H16F3N3O3/c19-18(20,21)16(23-24-22)15(12-26-11-13-7-3-1-4-8-13)27-17(25)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2/t15-,16+/m1/s1 |
| InChIKey | NCCDCNFMYZSHJL-CVEARBPZSA-N |
| XLogP | 4.67 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|