C11H10F3N3O3 — CID 11289235
[(2S,3S)-3-azido-4,4,4-trifluoro-1-hydroxybutan-2-yl] benzoate (PubChem CID 11289235) has the molecular formula C11H10F3N3O3 and a molecular weight of 289.21 g/mol. Its IUPAC name is [(2S,3S)-3-azido-4,4,4-trifluoro-1-hydroxybutan-2-yl] benzoate.
| Compound Name | [(2S,3S)-3-azido-4,4,4-trifluoro-1-hydroxybutan-2-yl] benzoate |
|---|---|
| PubChem CID | 11289235 |
| Molecular Formula | C11H10F3N3O3 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | [(2S,3S)-3-azido-4,4,4-trifluoro-1-hydroxybutan-2-yl] benzoate |
| SMILES | [N-]=[N+]=N[C@@H]([C@@H](CO)OC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H10F3N3O3/c12-11(13,14)9(16-17-15)8(6-18)20-10(19)7-4-2-1-3-5-7/h1-5,8-9,18H,6H2/t8-,9+/m1/s1 |
| InChIKey | LPMCMYLCGFTQNM-BDAKNGLRSA-N |
| XLogP | 2.45 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|