C14H16FN3O4 — CID 134933589
[(1S)-1-[(2S,3R,4S,5R)-3-azido-5-fluoro-4-methoxyoxolan-2-yl]ethyl] benzoate (PubChem CID 134933589) has the molecular formula C14H16FN3O4 and a molecular weight of 309.30 g/mol. Its IUPAC name is [(1S)-1-[(2S,3R,4S,5R)-3-azido-5-fluoro-4-methoxyoxolan-2-yl]ethyl] benzoate.
| Compound Name | [(1S)-1-[(2S,3R,4S,5R)-3-azido-5-fluoro-4-methoxyoxolan-2-yl]ethyl] benzoate |
|---|---|
| PubChem CID | 134933589 |
| Molecular Formula | C14H16FN3O4 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | [(1S)-1-[(2S,3R,4S,5R)-3-azido-5-fluoro-4-methoxyoxolan-2-yl]ethyl] benzoate |
| SMILES | CO[C@H]1[C@H](N=[N+]=[N-])[C@@H]([C@H](C)OC(=O)c2ccccc2)O[C@@H]1F |
| InChI | InChI=1S/C14H16FN3O4/c1-8(21-14(19)9-6-4-3-5-7-9)11-10(17-18-16)12(20-2)13(15)22-11/h3-8,10-13H,1-2H3/t8-,10+,11+,12-,13-/m0/s1 |
| InChIKey | NVMGZXOUWDBYFE-ZENYVHOSSA-N |
| XLogP | 2.62 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|