C27H37F2N3O7SSi — CID 11520075
[(2R,4R,5R)-2-azido-6-[tert-butyl(dimethyl)silyl]oxy-3,3-difluoro-5-methylsulfonyloxy-4-phenylmethoxyhexyl] benzoate (PubChem CID 11520075) has the molecular formula C27H37F2N3O7SSi and a molecular weight of 613.76 g/mol. Its IUPAC name is [(2R,4R,5R)-2-azido-6-[tert-butyl(dimethyl)silyl]oxy-3,3-difluoro-5-methylsulfonyloxy-4-phenylmethoxyhexyl] benzoate.
| Compound Name | [(2R,4R,5R)-2-azido-6-[tert-butyl(dimethyl)silyl]oxy-3,3-difluoro-5-methylsulfonyloxy-4-phenylmethoxyhexyl] benzoate |
|---|---|
| PubChem CID | 11520075 |
| Molecular Formula | C27H37F2N3O7SSi |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | [(2R,4R,5R)-2-azido-6-[tert-butyl(dimethyl)silyl]oxy-3,3-difluoro-5-methylsulfonyloxy-4-phenylmethoxyhexyl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](OS(C)(=O)=O)[C@@H](OCc1ccccc1)C(F)(F)[C@@H](COC(=O)c1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C27H37F2N3O7SSi/c1-26(2,3)41(5,6)38-18-22(39-40(4,34)35)24(36-17-20-13-9-7-10-14-20)27(28,29)23(31-32-30)19-37-25(33)21-15-11-8-12-16-21/h7-16,22-24H,17-19H2,1-6H3/t22-,23-,24-/m1/s1 |
| InChIKey | DJTSAAWIUOPMAD-WXFUMESZSA-N |
| XLogP | 6.11 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|